A4380412
7-Fluorooxindole , 95% , 71294-03-6
CAS NO.:71294-03-6
Empirical Formula: C8H6FNO
Molecular Weight: 151.14
MDL number: MFCD02179608
EINECS: 676-237-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB55.20 | In Stock |
|
| 1G | RMB153.60 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25g | RMB1983.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190°C |
| Boiling point: | 297.9±40.0 °C(Predicted) |
| Density | 1.311±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| pka | 12.93±0.20(Predicted) |
| color | Red-brown |
| InChI | InChI=1S/C8H6FNO/c9-6-3-1-2-5-4-7(11)10-8(5)6/h1-3H,4H2,(H,10,11) |
| InChIKey | VMUIOEOYZHJLEZ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2F)CC1=O |
| LogP | 0.7 at 25℃ and pH6.8 |
| CAS DataBase Reference | 71294-03-6(CAS DataBase Reference) |
Description and Uses
7-Fluorooxindole serves as a precursor for diazooxindole, which efficiently generates spirocyclic products[3].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C,Xn |
| Risk Statements | 36/37/38-34-22 |
| Safety Statements | 26-36/37/39-45-27 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 2933790090 |
| REACH Registrations | Active |







