A4383212
3-Fluoro-4-(trifluoromethyl)benzoic acid , ≥98.0%(GC) , 115754-21-7
CAS NO.:115754-21-7
Empirical Formula: C8H4F4O2
Molecular Weight: 208.11
MDL number: MFCD00236279
EINECS: 624-783-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB144.80 | In Stock |
|
| 25G | RMB497.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-179 °C (lit.) |
| Boiling point: | 251℃ |
| Density | 1.489 |
| Flash point: | 106℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.35±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C8H4F4O2/c9-6-3-4(7(13)14)1-2-5(6)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | HRIHSNPFVGMAKX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C(F)(F)F)C(F)=C1 |
| CAS DataBase Reference | 115754-21-7(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-(trifluoromethyl)benzoic acid serves as a crucial building block in the synthesis of potassium channel openers used for the treatment of epilepsy. The potassium channel openers are synthesised by condensation reactions involving 3-fluoro-4-(trifluoromethyl)benzoic acid and aminopyridine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






