A4386312
9-Fluorenylmethyl pentafluorophenyl carbonate , ≥98% , 88744-04-1
Synonym(s):
Fmoc pentafluorophenyl ester;Fmoc-OPfp
| Pack Size | Price | Stock | Quantity |
| 1G | RMB151.20 | In Stock |
|
| 5G | RMB545.60 | In Stock |
|
| 25G | RMB2480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C(lit.) |
| Boiling point: | 472.6±45.0 °C(Predicted) |
| Density | 1.457 |
| Flash point: | >110°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| color | White to Almost white |
| λmax | 300nm(EtOH)(lit.) |
| BRN | 4594899 |
| InChI | InChI=1S/C21H11F5O3/c22-15-16(23)18(25)20(19(26)17(15)24)29-21(27)28-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
| InChIKey | CBBKZVZOEBSFQX-UHFFFAOYSA-N |
| SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)OCC1C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 88744-04-1(CAS DataBase Reference) |
Description and Uses
Reagent for amino acid protection-activation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29209090 |
| Storage Class | 11 - Combustible Solids |
