A4393412
2-Fluoro-6-(trifluoromethyl)benzoyl Chloride , >98.0%(GC)(T) , 109227-12-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB148.80 | In Stock |
|
| 5G | RMB316.80 | In Stock |
|
| 25g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 194 °C (lit.) |
| Density | 1.465 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 180 °F |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.465 |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C8H3ClF4O/c9-7(14)6-4(8(11,12)13)2-1-3-5(6)10/h1-3H |
| InChIKey | ZDRYDSJMVRRAAF-UHFFFAOYSA-N |
| SMILES | Fc1cccc(c1C(Cl)=O)C(F)(F)F |
| CAS DataBase Reference | 109227-12-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






