A4395512
4-Fluorobenzyl Cyanide , >98.0%(GC) , 459-22-3
Synonym(s):
4-Fluorobenzyl cyanide
CAS NO.:459-22-3
Empirical Formula: C8H6FN
Molecular Weight: 135.14
MDL number: MFCD00001917
EINECS: 207-286-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB212.00 | In Stock |
|
| 500g | RMB739.20 | In Stock |
|
| 250G | RMB751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86°C |
| Boiling point: | 119-120 °C/18 mmHg (lit.) |
| Density | 1.126 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 227 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear colorless to light yellow |
| BRN | 1907764 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C8H6FN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| InChIKey | JHQBLYITVCBGTO-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=C(F)C=C1 |
| CAS DataBase Reference | 459-22-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluorophenylacetic acid nitrile(459-22-3) |
| EPA Substance Registry System | Benzeneacetonitrile, 4-fluoro- (459-22-3) |
Description and Uses
4-Fluorophenylacetonitrile is used as a reagent in the synthesis of novel Daidzein analogs which exhibit anti-influenza activity in vitro. It is also used as a reagent in the synthesis of benzylbenzo[d]thiazole sulfonamides which exhibit anti-inflammatory activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38-20/21/22/36/37/38-20/20/22 |
| Safety Statements | 26-36-24/25-26/36/37/39 |
| RIDADR | UN 3276 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | AM0210000 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







