PRODUCT Properties
| Melting point: | 163-165 °C (lit.) |
| Boiling point: | 245.64°C (rough estimate) |
| Density | 1.1083 (rough estimate) |
| refractive index | 1.4440 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Yellow |
| BRN | 383882 |
| InChI | InChI=1S/C10H6O4/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6H |
| InChIKey | SXPUVBFQXJHYNS-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CO1)(=O)C(C1=CC=CO1)=O |
| CAS DataBase Reference | 492-94-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanedione, di-2-furanyl-(492-94-4) |
| EPA Substance Registry System | Ethanedione, di-2-furanyl- (492-94-4) |
Description and Uses
Furil was used in preparation of dioxomolybdenum(VI) complexes in situ.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | LV0580000 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29321900 |
