PRODUCT Properties
| Melting point: | 117-119 °C (lit.) |
| Boiling point: | 238.4±23.0 °C(Predicted) |
| Density | 1.2099 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | powder to crystal |
| pka | 15.27±0.50(Predicted) |
| color | White to Almost white |
| BRN | 2325863 |
| InChI | InChI=1S/C7H6FNO/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10) |
| InChIKey | KGGHWIKBOIQEAJ-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C1=CC=CC=C1F |
| CAS DataBase Reference | 445-28-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzamide, 2-fluoro-(445-28-3) |
| EPA Substance Registry System | Benzamide, 2-fluoro- (445-28-3) |
Description and Uses
2-Fluorobenzamide can be useful in microwave assisted preparation of oxazole-dehydrozingerone based hybrid molecules as anti-tubercular agents and their docking for Mtb DNA gyrase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| RTECS | CV4953333 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
