A4402512
4-Fluorophenyl Methyl Sulfone , >98.0%(GC) , 455-15-2
CAS NO.:455-15-2
Empirical Formula: C7H7FO2S
Molecular Weight: 174.19
MDL number: MFCD00039753
EINECS: 207-237-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB43.20 | In Stock |
|
| 5G | RMB126.40 | In Stock |
|
| 25G | RMB483.20 | In Stock |
|
| 100G | RMB1903.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-81 °C (lit.) |
| Boiling point: | 95-97°C 7mm |
| Density | 1.2768 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane, Dimethyl Sulfoxide, Methanol |
| form | Adhering Crystalline Powder |
| color | Almost white |
| BRN | 2045674 |
| InChI | InChI=1S/C7H7FO2S/c1-11(9,10)7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | DPJHZJGAGIWXTD-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(S(C)(=O)=O)C=C1 |
| CAS DataBase Reference | 455-15-2(CAS DataBase Reference) |
Description and Uses
4-Fluorophenyl methyl sulfone was used in the preparation of 4-(4′-trifluoromethoxyphenoxy)phenyl methyl sulfone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |







