A4373512
Bis(4-fluorophenyl) sulfone , 99% , 383-29-9
Synonym(s):
4,4′-Difluorodiphenyl sulfone;4-Fluorophenyl sulfone;Bis(4-fluorophenyl) sulfone
CAS NO.:383-29-9
Empirical Formula: C12H8F2O2S
Molecular Weight: 254.25
MDL number: MFCD00000350
EINECS: 206-847-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.80 | In Stock |
|
| 10g | RMB61.60 | In Stock |
|
| 25G | RMB122.40 | In Stock |
|
| 100G | RMB455.20 | In Stock |
|
| 250g | RMB1136.80 | In Stock |
|
| 500g | RMB2207.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100 °C(lit.) |
| Boiling point: | 367.9±27.0 °C(Predicted) |
| Density | 1.3538 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | soluble in Methanol |
| form | Crystals or Powder |
| color | White to brown |
| BRN | 1970911 |
| InChI | InChI=1S/C12H8F2O2S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8H |
| InChIKey | PLVUIVUKKJTSDM-UHFFFAOYSA-N |
| SMILES | S(C1=CC=C(F)C=C1)(C1=CC=C(F)C=C1)(=O)=O |
| CAS DataBase Reference | 383-29-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Sulfone, bis(4-fluorophenyl)-(383-29-9) |
| EPA Substance Registry System | Benzene, 1,1'-sulfonylbis[4-fluoro- (383-29-9) |
Description and Uses
4-Fluorophenylsulfone was used in substitution reactions with deprotonated amines.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H331-H302-H315-H319-H411 |
| Precautionary statements | P501-P261-P273-P270-P271-P264-P280-P302+P352-P391-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P304+P340+P311-P403+P233-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29309070 |
| Storage Class | 11 - Combustible Solids |







