M1515741
Tetradifon , Analysis standard , 116-29-0
Synonym(s):
2,4,4′,5-Tetrachlorodiphenyl sulfone
CAS NO.:116-29-0
Empirical Formula: C12H6Cl4O2S
Molecular Weight: 356.05
MDL number: MFCD00018127
EINECS: 204-134-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB520.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146.5-147.5° |
| Boiling point: | 484.0±45.0 °C(Predicted) |
| Density | 1.5630 (estimate) |
| storage temp. | 0-6°C |
| form | Solid |
| color | White to off-white |
| Water Solubility | 50ug/L(10 ºC) |
| Merck | 13,9273 |
| BRN | 2292528 |
| Major Application | agriculture environmental |
| InChI | 1S/C12H6Cl4O2S/c13-7-1-3-8(4-2-7)19(17,18)12-6-10(15)9(14)5-11(12)16/h1-6H |
| InChIKey | MLGCXEBRWGEOQX-UHFFFAOYSA-N |
| SMILES | Clc1ccc(cc1)S(=O)(=O)c2cc(Cl)c(Cl)cc2Cl |
| CAS DataBase Reference | 116-29-0(CAS DataBase Reference) |
| NIST Chemistry Reference | P-chlorophenyl, 2,4,5-trichlorophenyl sulfone(116-29-0) |
| EPA Substance Registry System | Tetradifon (116-29-0) |
Description and Uses
Acaricide. Ovicide on deciduous fruits, citrus, cotton and other crops.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | WR5850000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 116-29-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 556 mg/kg (Ben-dyke) |







