A4403912
4-Fluoro-3-nitroaniline , >98.0%(GC) , 364-76-1
CAS NO.:364-76-1
Empirical Formula: C6H5FN2O2
Molecular Weight: 156.11
MDL number: MFCD00007833
EINECS: 206-665-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB127.20 | In Stock |
|
| 250g | RMB303.20 | In Stock |
|
| 500G | RMB599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96 °C (lit.) |
| Boiling point: | 331.3±22.0 °C(Predicted) |
| Density | 0.43 g/cm3 (20℃) |
| Flash point: | 196 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.36±0.10(Predicted) |
| form | Powder |
| color | Ochre |
| Water Solubility | Insoluble |
| BRN | 2210199 |
| InChI | InChI=1S/C6H5FN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2 |
| InChIKey | LLIOADBCFIXIEU-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 364-76-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-fluoro-3-nitro-(364-76-1) |
| EPA Substance Registry System | 4-Fluoro-3-nitroaniline (364-76-1) |
Description and Uses
4-Fluoro-3-nitroaniline was used in the preparation of commercial hair dyes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H301-H335-H302 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 36/37-37/39-26 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 2 |
| RTECS | BY1700000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29214210 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








