A4327012
4-Fluoro-3-nitrobenzoic Acid , 98% , 453-71-4
CAS NO.：453-71-4
Empirical Formula: C7H4FNO4
Molecular Weight: 185.11
MDL number: MFCD00007058
EINECS: 207-221-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 100G | RMB287.20 | In Stock |
|
| 500g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-126 °C (lit.) |
| Boiling point: | 92°C 15mm |
| Density | 1.5071 (estimate) |
| Flash point: | 92°C/15mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL, clear, light yellow |
| pka | 3.54±0.10(Predicted) |
| form | Powder or Crystals |
| color | Light yellow to tan |
| Water Solubility | insoluble |
| BRN | 2107562 |
| InChI | InChI=1S/C7H4FNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11) |
| InChIKey | BOJWTAQWPVBIPG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 453-71-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluoro-3-nitrobenzoic acid(453-71-4) |
Description and Uses
4-Fluoro-3-nitrobenzoic acid was used:
- as starting reagent in the preparation of novel benzimidazoles having antimycobacterial activity
- in preparation of series of novel acetylcholinesterase (AChE) and butyrylcholinesterase (BChE) inhibitors containing benzimidazole core structure
- in preparation of bis(heterocyclic) skeletal precursors for the Pictet-Spengler reaction
- in solid-phase synthesis of trisubstituted [1,3,5]triazino[1,2-a]benzimidazole-2,4(3H,10H)-diones
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
