A5683712
Methyl 4-Fluoro-3-nitrobenzoate , >98.0%(GC) , 329-59-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 10g | RMB51.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 500g | RMB1612.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-59℃ |
| Boiling point: | 299°C |
| Density | 1.388 |
| Flash point: | 135°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| color | White to Yellow to Green |
| Water Solubility | Soluble in ethanol, ether and methanol. Insoluble in water. |
| InChI | InChI=1S/C8H6FNO4/c1-14-8(11)5-2-3-6(9)7(4-5)10(12)13/h2-4H,1H3 |
| InChIKey | CNJJSTPBUHAEFH-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(F)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 329-59-9(CAS DataBase Reference) |
Description and Uses
Methyl 4-fluoro-3-nitrobenzoate is used to prepare dimethyl 3-nitro-3',4-oxydibenzoate by reacting with 3-hydroxy-benzoic acid methyl ester.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2916310090 |
