A4405712
2-Fluoro-6-(trifluoromethyl)benzoic Acid , >98.0%(HPLC) , 32890-94-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB81.60 | In Stock |
|
| 5G | RMB151.20 | In Stock |
|
| 25g | RMB587.20 | In Stock |
|
| 100g | RMB2284.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C (lit.) |
| Boiling point: | 232℃ |
| Density | 1.489 |
| Flash point: | 94℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Chunks |
| pka | 2.30±0.36(Predicted) |
| color | White to pale yellow |
| BRN | 2112882 |
| InChI | InChI=1S/C8H4F4O2/c9-5-3-1-2-4(8(10,11)12)6(5)7(13)14/h1-3H,(H,13,14) |
| InChIKey | LNARMXLVVGHCRP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(C(F)(F)F)C=CC=C1F |
| CAS DataBase Reference | 32890-94-1(CAS DataBase Reference) |
Description and Uses
2-Fluoro-6-(trifluoromethyl)benzoic acid may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
