A4406112
3-(4-Fluorophenyl)propionic Acid , >98.0%(GC) , 459-31-4
CAS NO.：459-31-4
Empirical Formula: C9H9FO2
Molecular Weight: 168.16
MDL number: MFCD00060327
EINECS: 670-328-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB128.16 | In Stock |
|
| 25G | RMB409.60 | In Stock |
|
| 100G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-91 °C (lit.) |
| Boiling point: | 105-107 °C(Press: 22 Torr) |
| Density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | slightly sol. in Methanol |
| pka | 4?+-.0.10(Predicted) |
| form | Crystalline Powder or Crystals |
| color | White to off-white |
| BRN | 1869084 |
| InChI | InChI=1S/C9H9FO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12) |
| InChIKey | ZMKXWDPUXLPHCA-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=C(F)C=C1 |
| CAS DataBase Reference | 459-31-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-(4-Fluorophenyl)propionic acid(459-31-4) |
Description and Uses
3-(4-Fluorophenyl)propionic acid may be used in the synthesis of 2-oxopiperazine guanidine analog.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 45-36/37/39-26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
