A4406612
4-Fluoro-2-methoxyphenol , >97.0%(GC) , 450-93-1
CAS NO.:450-93-1
Empirical Formula: C7H7FO2
Molecular Weight: 142.13
MDL number: MFCD00070797
EINECS: 626-485-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB66.40 | In Stock |
|
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB849.60 | In Stock |
|
| 100g | RMB2793.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 195 °C (lit.) |
| Density | 1.247 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 9.98±0.18(Predicted) |
| form | Liquid |
| Specific Gravity | 1.247 |
| color | Clear slightly yellow |
| BRN | 5425200 |
| InChI | InChI=1S/C7H7FO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3 |
| InChIKey | OULGLTLTWBZBLO-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C=C1OC |
| CAS DataBase Reference | 450-93-1(CAS DataBase Reference) |
Description and Uses
4-Fluoro-2-methoxyphenol may be used in the synthesis of:
- 4-halo-masked o-benzoquinones (MOBs)
- fluorinated masked o-benzoquinone
- poly(4-fluoro-2-methoxyphenol)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | TOXIC |
| HS Code | 29095000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





