A4408812
3-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine , >98.0%(GC)(T) , 719268-92-5
CAS NO.:719268-92-5
Empirical Formula: C11H15BFNO2
Molecular Weight: 223.05
MDL number: MFCD07780754
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB97.60 | In Stock |
|
| 1G | RMB246.40 | In Stock |
|
| 5G | RMB1207.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55.0 to 59.0 °C |
| Boiling point: | 294.5±25.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| pka | 2.80±0.22(Predicted) |
| color | White to Almost white |
| InChI | 1S/C11H15BFNO2/c1-10(2)11(3,4)16-12(15-10)8-5-9(13)7-14-6-8/h5-7H,1-4H3 |
| InChIKey | VFMTUTYBMBTIGA-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(OC1(C)C)c2cncc(F)c2 |
| CAS DataBase Reference | 719268-92-5 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |






