A4409912
4-Fluoro-<small>L</small>-2-phenylglycine , 98% , 19883-57-9
CAS NO.：19883-57-9
Empirical Formula: C8H8FNO2
Molecular Weight: 169.15
MDL number: MFCD00213799
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB276.00 | In Stock |
|
| 100G | RMB1078.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C |
| alpha | 138 º (c=1%,1N HCl) |
| Boiling point: | 289.9±30.0 °C(Predicted) |
| Density | 1.2345 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in 1M HCl. |
| form | Solid |
| pka | 1.90±0.10(Predicted) |
| color | White to off-white |
| optical activity | Consistent with structure |
| InChI | InChI=1/C8H8FNO2/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/s3 |
| InChIKey | JKFYKCYQEWQPTM-KPOCXSGKNA-N |
| SMILES | [C@@H](N)(C(=O)O)C1=CC=C(F)C=C1 |&1:0,r| |
| CAS DataBase Reference | 19883-57-9(CAS DataBase Reference) |
Description and Uses
4-Fluoro-L-phenylglycine is an optically active amino acid derivative that is used as an intermediate for making drugs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
