A4725212
4-Hydroxy-D-phenylglycine , 99% , 22818-40-2
Synonym(s):
(2R)-2-Amino-2-(4-hydroxyphenyl)acetic acid;4-Hydroxy-D -phenylglycine;Cefadroxyl impurity A
CAS NO.:22818-40-2
Empirical Formula: C8H9NO3
Molecular Weight: 167.16
MDL number: MFCD00004262
EINECS: 245-247-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB57.60 | In Stock |
|
| 100G | RMB120.00 | In Stock |
|
| 500G | RMB388.00 | In Stock |
|
| 2.5kg | RMB1609.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240 °C (dec.)(lit.) |
| alpha | -156 º (c=1, 1 N HCl) |
| Boiling point: | 295.73°C (rough estimate) |
| Density | 1.396 |
| vapor pressure | 0Pa at 25℃ |
| refractive index | -158 ° (C=1, 1mol/L HCl) |
| storage temp. | 2-8°C |
| solubility | 5g/l |
| pka | 2.15±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to yellow |
| optical activity | [α]23/D 158±3°, c = 1 in 1 M HCl |
| Water Solubility | 5 g/L (20 ºC) |
| BRN | 2210998 |
| Major Application | peptide synthesis |
| InChI | 1S/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/m1/s1 |
| InChIKey | LJCWONGJFPCTTL-SSDOTTSWSA-N |
| SMILES | N[C@@H](C(O)=O)c1ccc(O)cc1 |
| LogP | -2.25 |
| CAS DataBase Reference | 22818-40-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetic acid, .alpha.-amino-4-hydroxy-, (.alpha.R)- (22818-40-2) |
Description and Uses
d-(p-Hydroxyphenyl)glycine (d-HPG) is widely used in large amounts as an important intermediate for the synthesis of amoxicillin and several other semisynthetic β-lactam antibiotics.
4-Hydroxy-D-(-)-2-phenylglycine (Cefadroxil EP Impurity A(Amoxicillin EP Impurity A)) is an compound used mainly for the synthetic preparation of β-lactam antibiotics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29225000 |
| Storage Class | 13 - Non Combustible Solids |





