A4410112
4-Fluoro-L-phenylalanine , >98.0%(HPLC) , 1132-68-9
CAS NO.：1132-68-9
Empirical Formula: C9H10FNO2
Molecular Weight: 183.18
MDL number: MFCD00063064
EINECS: 145-896-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB164.80 | In Stock |
|
| 25g | RMB676.80 | In Stock |
|
| 100g | RMB2041.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~255 °C (dec.) |
| alpha | -26.5 º (c=1, H2O 25 ºC) |
| Boiling point: | 313.3±32.0 °C(Predicted) |
| Density | 1.1939 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 2.20±0.10(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| Water Solubility | Soluble in water and 0.5M HCl (50 mg/ml). |
| BRN | 2416148 |
| InChI | InChI=1S/C9H10FNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | XWHHYOYVRVGJJY-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(F)C=C1)N |
| CAS DataBase Reference | 1132-68-9(CAS DataBase Reference) |
Description and Uses
4-Fluoro-L-phenylalanine is a substrate for tyrosine hydroxylase (TH) that has been used to study the regulation of that enzyme.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| RTECS | DW1765000 |
| Hazard Note | Harmful |
| HS Code | 29224999 |
