A4410212
1-Fluoro-3-iodo-5-nitrobenzene , >98.0%(GC) , 3819-88-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB219.20 | In Stock |
|
| 5G | RMB661.60 | In Stock |
|
| 25g | RMB1989.60 | In Stock |
|
| 100g | RMB10399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-79 °C (lit.) |
| Boiling point: | 277.7±20.0 °C(Predicted) |
| Density | 2.093±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Powder and/or Chunks |
| color | Yellow to khaki or brown |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H3FINO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H |
| InChIKey | MXPYCSFCKXSPAB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC([N+]([O-])=O)=CC(I)=C1 |
Description and Uses
1-Fluoro-3-iodo-5-nitrobenzene may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29049090 |
