A4435012
Fmoc-4-Abz-OH , 96% , 185116-43-2
Synonym(s):
4-(Fmoc-amino)benzoic acid;Fmoc-PABA-OH;N-α-Fmoc-p-aminobenzoic acid,Fmoc-4-Abz-OH
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB33.60 | In Stock |
|
| 5g | RMB153.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~277 °C (dec.) |
| Boiling point: | 544.9±33.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.29±0.10(Predicted) |
| form | powder |
| Appearance | White to off-white Solid |
| BRN | 7722986 |
| Major Application | peptide synthesis |
| InChI | 1S/C22H17NO4/c24-21(25)14-9-11-15(12-10-14)23-22(26)27-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20H,13H2,(H,23,26)(H,24,25) |
| InChIKey | VGSYYBSAOANSLR-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(NC(=O)OCC2c3ccccc3-c4ccccc24)cc1 |
| CAS DataBase Reference | 185116-43-2(CAS DataBase Reference) |
Description and Uses
Fmoc-4-aminobenzoic acid is used in the improved rapid synthesis of oligo(benzamide) block copolymers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |






