A4463412
6-fluoropyridine-3-carbonitrile , 97% , 3939-12-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1G | RMB50.40 | In Stock |
|
| 5g | RMB959.20 | In Stock |
|
| 25g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-52℃ |
| Boiling point: | 223.8±20.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -3.88±0.10(Predicted) |
| form | Solid |
| color | Off-white |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H3FN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H |
| InChIKey | VRLVOMUVHHHJHB-UHFFFAOYSA-N |
| SMILES | C1=NC(F)=CC=C1C#N |
Description and Uses
It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | 3439 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






