A4469012
3-fluoropyridine-2-carbonitrile , 97% , 97509-75-6
Synonym(s):
2-Cyano-3-fluoropyridine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.92 | In Stock |
|
| 5G | RMB155.20 | In Stock |
|
| 25G | RMB415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-30°C |
| Boiling point: | 120-125 °C(Press: 17 Torr) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| Flash point: | 104 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), DMSO (Slightly) |
| form | Solid |
| pka | -2.74±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C6H3FN2/c7-5-2-1-3-9-6(5)4-8/h1-3H |
| InChIKey | VZFPSCNTFBJZHB-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC=C1F |
| CAS DataBase Reference | 97509-75-6(CAS DataBase Reference) |
Description and Uses
2-Cyano-3-fluoropyridine is an organic intermediate that can be prepared from 3-fluoropyridine in three steps.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H318-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-37/38 |
| Safety Statements | 26-36/37/39-23 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






