A4472212
3-Fluoro-2-methoxybenzoic acid , 98% , 106428-05-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB165.60 | In Stock |
|
| 5G | RMB496.80 | In Stock |
|
| 25G | RMB1914.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114°C |
| Boiling point: | 288℃ |
| Density | 1.307 |
| Flash point: | 128℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 3.75±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H7FO3/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4H,1H3,(H,10,11) |
| InChIKey | MEOOXZGGYVXUSG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(F)=C1OC |
| CAS DataBase Reference | 106428-05-1(CAS DataBase Reference) |
Description and Uses
3-Fluoro-2-methoxybenzoic acid is a fluorobenzoic acid derivative that can be used as a synthetic intermediate in pharmaceutical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 2918999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






