A4491012
3-Fluoro-5-nitrobenzoic acid , 97% , 14027-75-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB47.20 | In Stock |
|
| 1G | RMB117.60 | In Stock |
|
| 5G | RMB328.00 | In Stock |
|
| 25g | RMB1750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125°C |
| Boiling point: | 341.2±27.0 °C(Predicted) |
| Density | 1.568±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.14±0.10(Predicted) |
| form | Solid |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C7H4FNO4/c8-5-1-4(7(10)11)2-6(3-5)9(12)13/h1-3H,(H,10,11) |
| InChIKey | VIPUIECMSDQUIK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=CC(F)=C1 |
| CAS DataBase Reference | 14027-75-9(CAS DataBase Reference) |
Description and Uses
3-fluoro-5-nitrobenzoic acid is an industrial chemical with a variety of uses. It is used as an intermediate in the production of other chemicals and pharmaceuticals. 3-Fluoro-5-nitrobenzoic acid can be activated to form the corresponding sodium salt, which has been used as a reagent for organic synthesis. This chemical can also be used to produce n-oxides, such as phenoxides and nitrophenols. 3-Fluoro-5-nitrobenzoic acid is also used to synthesize industrial chemicals, including chlorides and benzene derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2916399090 |






