A4502912
2-Fluoro-6-formylpyridine , 95% , 208110-81-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB345.60 | In Stock |
|
| 5G | RMB1398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 192.4±20.0 °C(Predicted) |
| Density | 1.269±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 0.80±0.10(Predicted) |
| form | liquid |
| color | Clear, dark yellow |
| InChI | InChI=1S/C6H4FNO/c7-6-3-1-2-5(4-9)8-6/h1-4H |
| InChIKey | HENWRHPVXMPQNF-UHFFFAOYSA-N |
| SMILES | C1(C=O)=NC(F)=CC=C1 |
| CAS DataBase Reference | 208110-81-0(CAS DataBase Reference) |
Description and Uses
2-Fluoro-6-formylpyridine is used in the synthesis of fluoroheterocyclic aldoximes which are therapeutic agents for the treatment of anti-cholinesterase poisoning.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN2811 |
| HS Code | 2933399990 |







