A4505012
3-Fluoro-4-nitrobenzonitrile , 98% , 218632-01-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB49.60 | In Stock |
|
| 5G | RMB116.80 | In Stock |
|
| 25G | RMB531.20 | In Stock |
|
| 100g | RMB1319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-73°C |
| Boiling point: | 316.4±27.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C7H3FN2O2/c8-6-3-5(4-9)1-2-7(6)10(11)12/h1-3H |
| InChIKey | OZXCOGPRBUSXLE-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C([N+]([O-])=O)C(F)=C1 |
| CAS DataBase Reference | 218632-01-0(CAS DataBase Reference) |
Description and Uses
3-Fluoro-4-nitrobenzonitrile (cas# 218632-01-0) is a used in preparation of substituted benzimidazole derivatives as GLP-1r modulating compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazard Codes | Xi,C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| HazardClass | IRRITANT |
| HS Code | 2926907090 |
