A0596856
3-Fluoro-4-nitrophenol , 98% , 394-41-2
CAS NO.:394-41-2
Empirical Formula: C6H4FNO3
Molecular Weight: 157.1
MDL number: MFCD00041251
EINECS: 206-895-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5g | RMB239.20 | In Stock |
|
| 25g | RMB799.20 | In Stock |
|
| 100g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-95 °C (lit.) |
| Boiling point: | 323.6±27.0 °C(Predicted) |
| Density | 1.4306 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 6.42±0.10(Predicted) |
| form | Powder |
| color | Pale yellow to brown |
| BRN | 2048033 |
| InChI | 1S/C6H4FNO3/c7-5-3-4(9)1-2-6(5)8(10)11/h1-3,9H |
| InChIKey | CSSGKHVRDGATJL-UHFFFAOYSA-N |
| SMILES | Oc1ccc(c(F)c1)[N+]([O-])=O |
| CAS DataBase Reference | 394-41-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 3-fluoro-4-nitro-(394-41-2) |
| EPA Substance Registry System | 3-Fluoro-4-nitrophenol (394-41-2) |
Description and Uses
3-Fluoro-4-nitrophenol was used in solid phase synthesis of benzimidazoles and quinoxalin-2-ones. It was also used in the synthesis of 2-hydroxy-4-[(E,E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yloxy]nitrobenzene.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-39-36-36/37/39 |
| RIDADR | UN2811 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29089000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








