A4519212
3-Fluoro-4-nitroanisole , 98% , 446-38-8
CAS NO.:446-38-8
Empirical Formula: C7H6FNO3
Molecular Weight: 171.13
MDL number: MFCD04115632
EINECS: 695-695-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB247.20 | In Stock |
|
| 100g | RMB749.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57.3 |
| Boiling point: | 264.5±20.0 °C(Predicted) |
| Density | 1.321±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | crystalline solid |
| color | Off-white |
| InChI | InChI=1S/C7H6FNO3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| InChIKey | PLEJCMKVJYUUBA-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(OC)C=C1F |
Description and Uses
3-Fluoro-4-nitroanisole is synthesizing new antiseptic-germicide, sterilant, and the important organic fluoride-containing intermediate of liquid crystal material.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3261 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 2909309090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B STOT SE 3 |




