PRODUCT Properties
| Boiling point: | 58-62 °C/100 mbar |
| Density | 1.654 g/mL at 25 °C |
| refractive index | n20/D 1.5037 |
| Flash point: | 77 °C |
| pka | 14.35±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| InChI | InChI=1S/C3H5BrO/c1-3(4)2-5/h5H,1-2H2 |
| InChIKey | MDFFZNIQPLKQSG-UHFFFAOYSA-N |
| SMILES | C(O)C(Br)=C |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2905.59.1000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








