PRODUCT Properties
Boiling point: | 58-62 °C/100 mbar |
Density | 1.654 g/mL at 25 °C |
refractive index | n20/D 1.5037 |
Flash point: | 77 °C |
pka | 14.35±0.10(Predicted) |
form | clear liquid |
color | Colorless to Yellow to Orange |
InChI | InChI=1S/C3H5BrO/c1-3(4)2-5/h5H,1-2H2 |
InChIKey | MDFFZNIQPLKQSG-UHFFFAOYSA-N |
SMILES | C(O)C(Br)=C |
Safety
Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
Signal word | Danger |
Hazard statements | H302-H315-H318-H335 |
Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
Hazard Codes | Xn |
Risk Statements | 22-37/38-41 |
Safety Statements | 26-36/37/39 |
WGK Germany | 3 |
HS Code | 2905.59.1000 |