A4553312
2-Fluoro-3-methoxybenzoic acid , 98% , 137654-20-7
CAS NO.：137654-20-7
Empirical Formula: C8H7FO3
Molecular Weight: 170.14
MDL number: MFCD02179621
EINECS: 630-179-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB36.00 | In Stock |
|
| 1G | RMB52.80 | In Stock |
|
| 5g | RMB208.00 | In Stock |
|
| 25g | RMB751.20 | In Stock |
|
| 100g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-160°C |
| Boiling point: | 296.6±20.0 °C(Predicted) |
| Density | 1.307±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 3.15±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C8H7FO3/c1-12-6-4-2-3-5(7(6)9)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | AVGWCJLTQZQLCN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(OC)=C1F |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2918999090 |
