A4571812
9-Fluorenylmethyl N-hydroxycarbamate , 98% , 190656-01-0
Synonym(s):
N-(9-Fluorenylmethoxycarbonyl)hydroxylamine;N-Fmoc-hydroxylamine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.80 | In Stock |
|
| 5g | RMB153.60 | In Stock |
|
| 25G | RMB590.40 | In Stock |
|
| 100G | RMB2063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164.5 °C(lit.) |
| Boiling point: | 503.2±19.0 °C(Predicted) |
| Density | 1.304±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 8.82±0.23(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 7712144 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C15H13NO3/c17-15(16-18)19-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14,18H,9H2,(H,16,17) |
| InChIKey | HHNJBGORPSTJDX-UHFFFAOYSA-N |
| SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)NO |
Description and Uses
9-Fluorenylmethyl N-hydroxycarbamate (Fmoc-NHOH) can be used as a reactant to prepare:
- N-Fmoc-aminooxy-2-chlorotrityl polystyrene, a solid-phase resin used to produce hydroxamic acids and peptidyl hydroxamic acids.
- 9-Fluorenylmethyl nosyloxycarbamate (Fmoc-NHONs) by reacting with nosyl chloride.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





