![(R)-1-[(SP)-2-(Diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphine](https://img.chemicalbook.com/CAS/GIF/155806-35-2.gif)
A4599329
(R)-1-[(SP)-2-(Diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphine , ≥97% , 155806-35-2
Synonym(s):
(R)-(S)-Josiphos;(2R)-1-[(1R)-1-(Dicyclohexylphosphino)ethyl]-2-(diphenylphosphino)ferrocene (acc to CAS);Josiphos SL-J001-1
CAS NO.：155806-35-2
Empirical Formula: C36H44FeP210*
Molecular Weight: 594.53
MDL number: MFCD00800284
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB160.00 | In Stock |
|
| 250mg | RMB236.00 | In Stock |
|
| 500mg | RMB319.20 | In Stock |
|
| 1g | RMB484.00 | In Stock |
|
| 5g | RMB1456.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~95 °C (dec.) |
| alpha | -360° (c 0.5, CHCl3) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystals or Crystalline Powder |
| color | White |
| Stability: | store cold |
| InChIKey | HGTBZFMPHBAUCQ-IGHQBCTINA-N |
| SMILES | P(C1=CC=CC=C1)(C1C=CC=CC=1)[C]1[CH][CH][CH][C]1[C@@H](C)P(C1CCCCC1)C1CCCCC1.[CH]1[CH][CH][CH][CH]1.[Fe] |&1:18,r,^1:13,14,15,16,17,33,34,35,36,37| |
Description and Uses
It may be used in the preparation of cyclopentadienyliridium complexes, [IrCl(PP)]2 and [IrCp(PP)]. (Cp= cyclopentadienyl; PP= (R)-1-[(SP)-2-(diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphine)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29319090 |
