A4600356
3,4-Dihydroxy-5-nitrobenzoicAcid , 95% , 84211-30-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB215.20 | In Stock |
|
| 1g | RMB543.20 | In Stock |
|
| 5g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >222oC (dec.) |
| Boiling point: | 411.1±45.0 °C(Predicted) |
| Density | 1.799±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 3.82±0.10(Predicted) |
| color | Yellow to Beige |
| InChI | InChI=1S/C7H5NO6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,9-10H,(H,11,12) |
| InChIKey | HDPSONAKHMNQPA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=C(O)C(O)=C1 |
Description and Uses
3,4-Dihydroxy-5-nitrobenzoic Acid is a useful synthetic intermediate in the synthesis of Entacapone (E558500); a peripherally selective inhibitor of catechol-O-methyltransferase (COMT). Also an antiparkinsonian.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
