A4607712
Glycitin , Analysis of standard products, ≥98%(HPLC) , 40246-10-4
Synonym(s):
4′,7-Dihydroxy 6-methoxyisoflavone 7-O-glucoside;4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-3-(4-hydroxyphenyl)-6-methoxy-;Glycitein 7-O-β-glucoside
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 2100C |
| Boiling point: | 751.1±60.0 °C(Predicted) |
| Density | 1.545 |
| storage temp. | room temp |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Heated) |
| pka | 9.62±0.30(Predicted) |
| form | Solid |
| color | White to Off-White |
| biological source | plant (Pueraria thunbergianaI) |
| Water Solubility | 10mg, clear, colorless to faintly yellow |
| Stability: | Hygroscopic |
| InChIKey | OZBAVEKZGSOMOJ-MIUGBVLSSA-N |
| SMILES | O=C1C2=CC(OC)=C(O[C@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O3)C=C2OC=C1C4=CC=C(O)C=C4 |
| LogP | 0.156 (est) |
| CAS DataBase Reference | 40246-10-4(CAS DataBase Reference) |
Description and Uses
A metabolite of isoflavone derivatives. A derivative of Glycitein. Inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |





