A7010758
Calycosin , 10mMinDMSO , 20575-57-9
Synonym(s):
3′,7-Dihydroxy-4′-methoxy-isoflavone;3′-Hydroxyformononetin;Cyclosin
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245~247℃ |
| Boiling point: | 536.8±50.0 °C(Predicted) |
| Density | 1.420±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | methanol: soluble1mg/mL, clear, colorless |
| pka | 6.94±0.20(Predicted) |
| form | powder |
| color | white to light yellow |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | InChI=1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3 |
| InChIKey | ZZAJQOPSWWVMBI-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(O)=CC=C2C(=O)C=1C1=CC=C(OC)C(O)=C1 |
Description and Uses
Calycosin is a known antioxidant that prevent redox imbalance in organisms. Also, it possesses anti-tumor, anti-inflammation and osteogenic properties; Useful as a therapeutic reagent for bone loss-associated diseases.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 3462 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 2932996560 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
| Hazardous Substances Data | 20575-57-9(Hazardous Substances Data) |





