Glutathione (Reduced) , 98% , 70-18-8
Synonym(s):
GSH;Glutathione (reduced);Glutathione, Reduced, Free Acid - CAS 70-18-8 - Calbiochem;γ-L -Glutamyl-L -cysteinyl-glycine;γ-Glu-Cys-Gly, GSH
CAS NO.:70-18-8
Empirical Formula: C10H17N3O6S
Molecular Weight: 307.32
MDL number: MFCD00065939
EINECS: 200-725-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 10G | RMB80.00 | In Stock |
|
| 25G | RMB102.40 | In Stock |
|
| 50G | RMB196.00 | In Stock |
|
| 100G | RMB387.20 | In Stock |
|
| 250G | RMB799.20 | In Stock |
|
| 500g | RMB1281.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 192-195 °C (dec.) (lit.) |
| Boiling point: | 754.5±60.0 °C(Predicted) |
| alpha | -16.5 º (c=2, H2O) |
| Density | 1.4482 (rough estimate) |
| bulk density | 160kg/m3 |
| refractive index | -17 ° (C=2, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| pka | pK1 2.12; pK2 3.53; pK3 8.66; pK4 9.12(at 25℃) |
| color | White |
| PH | 3 (10g/l, H2O, 20°C) |
| Odor | Odorless |
| optical activity | -21.327 (H2O) |
| Water Solubility | soluble |
| Merck | 14,4475 |
| BRN | 1729812 |
| Sequence | H-γ-Glu-Cys-Gly-OH |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | REDUCING |
| InChI | 1S/C10H17N3O6S/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/t5-,6-/m0/s1 |
| InChIKey | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O)C(O)=O |
| LogP | -1.645 (est) |
| CAS DataBase Reference | 70-18-8(CAS DataBase Reference) |
| EPA Substance Registry System | Glutathione (70-18-8) |
Description and Uses
Glutathione (GSH) is a tripeptide (γ-
glutathione is a peptide composed of cysteine, glycine, and glutamate. It is believed to enhance the skin’s cellular metabolism and oxygen utilization. It has been found to protect the fibroblast against free radical-induced oxidation and act as a powerful antioxidant. Studies indicate that it can inactivate the tyrosinase enzyme and quench free radicals that contribute to tyrosinase and melanin formation, thereby serving as a skin-lightening or de- pigmenting agent. glutathione is a component of plant and animal tissue, naturally occurring in the body and essential for the proper functioning of the immune system.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 68-36/37/38 |
| Safety Statements | 24/25-36/37/39-27-26 |
| WGK Germany | 2 |
| RTECS | MC0556000 |
| F | 9-23 |
| TSCA | TSCA listed |
| HS Code | 29309070 |
| Storage Class | 11 - Combustible Solids |





