M5339935
Sodiumglycocholatehydrate , 98% , 863-57-0
CAS NO.:863-57-0
Empirical Formula: C26H42NNaO6
Molecular Weight: 487.6
MDL number: MFCD00036741
EINECS: 212-730-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB78.40 | In Stock |
|
| 1g | RMB184.00 | In Stock |
|
| 5g | RMB524.00 | In Stock |
|
| 25g | RMB1574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-215 °C (subl.)(lit.) |
| refractive index | 30 ° (C=1, H2O) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 3.8 |
| form | Solid |
| color | White to Off-White |
| Water Solubility | water: 200mg/mL ethanol: soluble |
| Merck | 4494 |
| Stability: | Hygroscopic |
| InChIKey | OABYVIYXWMZFFJ-SEUIPJRTNA-M |
| SMILES | [Na+].N(CC(=O)[O-])C(=O)CCC(C1C2(C(C3C(C4(C(CC3O)CC(CC4)O)C)CC2O)CC1)C)C |
| CAS DataBase Reference | 863-57-0(CAS DataBase Reference) |
Description and Uses
Glycocholic Acid Sodium Salt is a biochemical formed by the conjugation of cholic acid (C432600) with glycine (G615990).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | MB9265100 |
| F | 3-9 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







