A4614912
GTP, Trisodium Salt , 95% , 36051-31-7
Synonym(s):
5′-GTP-Na2;GTP
CAS NO.：36051-31-7
Empirical Formula: C10H17N5NaO14P3
Molecular Weight: 547.18
MDL number: MFCD00084663
EINECS: 252-847-2
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB73.60 | In Stock |
|
| 25MG | RMB159.20 | In Stock |
|
| 100MG | RMB284.80 | In Stock |
|
| 250MG | RMB660.00 | In Stock |
|
| 1G | RMB1496.00 | In Stock |
|
| 5G | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254 - 256°C |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | white |
| biological source | Porcine brain bacterial (Corynebacterium) yeast |
| optical activity | [α]20/D 24±2°, c = 1% in 0.5 M Na2HPO4 |
| Water Solubility | H2O: 50mg/mL |
| BRN | 4113439 |
| Stability: | Hygroscopic |
| InChIKey | XIZYETZGWBYYEH-NGPBCCOENA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(NC(N)=NC1=2)=O)O.[NaH] |&1:1,2,3,19,r| |
| CAS DataBase Reference | 36051-31-7(CAS DataBase Reference) |
Description and Uses
Guanosine 5′-triphosphate sodium salt solution has been used for reconstituting transducin during purification of transducin.
Safety
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38-39/23/24/25 |
| Safety Statements | 26-36/37/39-45 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29349990 |
