A4614912
                    GTP, Trisodium Salt , 95% , 36051-31-7
                            Synonym(s):
5′-GTP-Na2;GTP
                            
                        
                CAS NO.:36051-31-7
Empirical Formula: C10H17N5NaO14P3
Molecular Weight: 547.18
MDL number: MFCD00084663
EINECS: 252-847-2
| Pack Size | Price | Stock | Quantity | 
| 10MG | RMB73.60 | In Stock | 
                                                 | 
                                        
| 25MG | RMB159.20 | In Stock | 
                                                 | 
                                        
| 100MG | RMB284.80 | In Stock | 
                                                 | 
                                        
| 250MG | RMB660.00 | In Stock | 
                                                 | 
                                        
| 1G | RMB1496.00 | In Stock | 
                                                 | 
                                        
| 5G | RMB5599.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 254 - 256°C | 
                                    
| storage temp. | -20°C | 
                                    
| solubility | H2O: 50 mg/mL | 
                                    
| form | powder | 
                                    
| color | white | 
                                    
| biological source | Porcine brain bacterial (Corynebacterium) yeast  | 
                                    
| optical activity | [α]20/D 24±2°, c = 1% in 0.5 M Na2HPO4 | 
                                    
| Water Solubility | H2O: 50mg/mL | 
                                    
| BRN | 4113439 | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChIKey | XIZYETZGWBYYEH-NGPBCCOENA-N | 
                                    
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(NC(N)=NC1=2)=O)O.[NaH] |&1:1,2,3,19,r| | 
                                    
| CAS DataBase Reference | 36051-31-7(CAS DataBase Reference) | 
                                    
Description and Uses
                                            Guanosine 5′-triphosphate sodium salt solution has been used for reconstituting transducin during purification of transducin.
                                        
Safety
| Hazard Codes | T | 
| Risk Statements | 23/24/25-36/37/38-39/23/24/25 | 
| Safety Statements | 26-36/37/39-45 | 
| WGK Germany | 3 | 
| F | 10-21 | 
| HS Code | 29349990 | 




