A4615412
(-)-Gallocatechin gallate , 98% , 4233-96-9
Synonym(s):
(2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol 3-(3,4,5-trihydroxybenzoate)
CAS NO.:4233-96-9
Empirical Formula: C22H18O11
Molecular Weight: 458.37
MDL number: MFCD00214298
EINECS: 636-979-1
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB559.20 | In Stock |
|
| 100MG | RMB1904.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >179oC (dec.) |
| Boiling point: | 909.1±65.0 °C(Predicted) |
| Density | 1.90±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 7.75±0.25(Predicted) |
| form | Solid |
| color | Off-White to Pale Brown |
| biological source | green tea |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21+/m1/s1 |
| InChIKey | WMBWREPUVVBILR-NQIIRXRSSA-N |
| SMILES | Oc1cc(O)c2C[C@@H](OC(=O)c3cc(O)c(O)c(O)c3)[C@@H](Oc2c1)c4cc(O)c(O)c(O)c4 |
| LogP | 2.080 (est) |
| CAS DataBase Reference | 4233-96-9(CAS DataBase Reference) |
Description and Uses
(-)-Gallocatechin Gallate is a catechins found in green tea that has shown to suppress the activity of cytochrome P 450 1A1.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-26/36 |
| WGK Germany | 3 |
| RTECS | DH9000000 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





