A4618412
D-Glucal , 96% , 13265-84-4
Synonym(s):
1,5-Anhydro-2-deoxy-D -arabino-hex-1-enitol
CAS NO.：13265-84-4
Empirical Formula: C6H10O4
Molecular Weight: 146.14
MDL number: MFCD00067186
EINECS: 236-259-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB271.20 | In Stock |
|
| 25g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-60 °C (lit.) |
| Boiling point: | 325.5±42.0 °C(Predicted) |
| Density | 1.414±0.06 g/cm3(Predicted) |
| refractive index | -10 ° (C=2, H2O) |
| storage temp. | 2-8°C |
| solubility | Soluble in Methanol. |
| pka | 12.79±0.60(Predicted) |
| form | Solid |
| color | White |
| optical activity | [α]21/D 7°, c = 1.9 in H2O |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C6H10O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,4-9H,3H2/t4-,5-,6+/m1/s1 |
| InChIKey | YVECGMZCTULTIS-PBXRRBTRSA-N |
| SMILES | C1O[C@H](CO)[C@@H](O)[C@H](O)C=1 |
| CAS DataBase Reference | 13265-84-4(CAS DataBase Reference) |
Description and Uses
It is an important building block for both solution- and solid-phase synthesis of oligosaccharides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 21-36/38-46-62-63-36/37/38 |
| Safety Statements | 22-24/25-53-36/37-26-25-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
