A4618512
beta-D-Galactose Pentaacetate , 98% , 4163-60-4
CAS NO.:4163-60-4
Empirical Formula: C16H22O11
Molecular Weight: 390.34
MDL number: MFCD00063259
EINECS: 224-008-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB72.80 | In Stock |
|
| 100G | RMB226.40 | In Stock |
|
| 250g | RMB527.20 | In Stock |
|
| 500g | RMB925.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-144 °C(lit.) |
| alpha | 25 º (c=10,CHCl3,on dry ba) |
| Boiling point: | 435.58°C (rough estimate) |
| Density | 1.3984 (rough estimate) |
| refractive index | 23.5 ° (C=2, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | methanol: 50 mg/mL, clear |
| form | powder |
| color | White |
| Water Solubility | Soluble in methanol (50 mg/ml), chloroform, and water. |
| BRN | 98853 |
| InChI | InChI=1/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13+,14+,15-,16-/s3 |
| InChIKey | LPTITAGPBXDDGR-FTTYHUIRNA-N |
| SMILES | [C@@H]1(OC(=O)C)[C@@H](OC(=O)C)[C@@H](O[C@H](COC(=O)C)[C@@H]1OC(=O)C)OC(=O)C |&1:0,5,10,12,18,r| |
| CAS DataBase Reference | 4163-60-4(CAS DataBase Reference) |
| EPA Substance Registry System | .beta.-D-Galactopyranose, pentaacetate (4163-60-4) |
Description and Uses
It is used as a pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-27-26 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |




