A4620212
L-Glutamic acid dimethyl ester hydrochloride , 98% , 23150-65-4
CAS NO.：23150-65-4
Empirical Formula: C7H14ClNO4
Molecular Weight: 211.64
MDL number: MFCD00038879
EINECS: 245-461-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB160.00 | In Stock |
|
| 500g | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-90°C |
| alpha | 26 º (c=5% in H2O) |
| refractive index | 26 ° (C=5, H2O) |
| storage temp. | 2-8°C |
| solubility | Methanol, Water |
| form | Powder |
| color | White |
| optical activity | [α]20/D +26.0±1°, c = 5% in H2O |
| Water Solubility | Soluble in water, methanol (50 mg/ml). |
| Sensitive | Hygroscopic |
| BRN | 4238829 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C7H13NO4.ClH/c1-11-6(9)4-3-5(8)7(10)12-2;/h5H,3-4,8H2,1-2H3;1H/t5-;/s3 |
| InChIKey | MFUPLHQOVIUESQ-JEDNCBNOSA-N |
| SMILES | [C@@H](N)(C(=O)OC)CCC(=O)OC.Cl |&1:0,r| |
| CAS DataBase Reference | 23150-65-4(CAS DataBase Reference) |
Description and Uses
L-Glutamic Acid Dimethyl Ester is a diester analogue of L-Glutamic Acid, a non-essential amino acid. L-Glutamic Acid Dimethyl Ester has been shown to antagonize the effects of morphine sulfate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
