A4642112
Glycyl-L-tyrosine Hydrate , 98% , 658-79-7
Synonym(s):
Glycyl-L -tyrosine
CAS NO.:658-79-7
Empirical Formula: C11H14N2O4
Molecular Weight: 238.24
MDL number: MFCD00008126
EINECS: 211-525-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB56.00 | In Stock |
|
| 10g | RMB102.40 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100g | RMB524.00 | In Stock |
|
| 500g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 278-285 °C (dec.) |
| Boiling point: | 568.4±50.0 °C(Predicted) |
| Density | 1.362±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 47.5 ° (C=1, H2O) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly, Sonicated) |
| pka | 2.95±0.10(Predicted) |
| form | Solid |
| color | White to pale yellow |
| Water Solubility | 44.1g/L at 25℃ |
| BRN | 2700715 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H14N2O4/c12-6-10(15)13-9(11(16)17)5-7-1-3-8(14)4-2-7/h1-4,9,14H,5-6,12H2,(H,13,15)(H,16,17)/t9-/m0/s1 |
| InChIKey | XBGGUPMXALFZOT-VIFPVBQESA-N |
| SMILES | NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(O)=O |
| LogP | -0.45 at 25℃ |
| CAS DataBase Reference | 658-79-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Glycyl-l-tyrosine(658-79-7) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P260-P261-P264-P271-P280-P302+P352-P303+P361+P353-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P370+P378-P403-P403+P233-P403+P235-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |








