A4667912
Gly-gly-leu , 95% , 14857-82-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-198 °C (decomp) |
| Boiling point: | 573.7±45.0 °C(Predicted) |
| Density | 1.199±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | PBS (pH 7.2): Sparingly soluble: 1-10 mg/ml |
| form | Solid |
| pka | 3.35±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C10H19N3O4/c1-6(2)3-7(10(16)17)13-9(15)5-12-8(14)4-11/h6-7H,3-5,11H2,1-2H3,(H,12,14)(H,13,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | XPJBQTCXPJNIFE-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@H](CC(C)C)NC(=O)CNC(=O)CN |
| CAS DataBase Reference | 14857-82-0(CAS DataBase Reference) |
Description and Uses
Gly-gly-leu is an oligopeptide, and also functions as a plant growth regulator.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
