A4649012
Ganciclovir , ≥98.0% , 82410-32-0
Synonym(s):
Ganciclovir;GNC;2-Amino-1,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6H-purin-6-one;9-(1,3-Dihydroxy-2-propoxymethyl)guanine;9-[(1,3-Dihydroxy-2-propoxy)methyl]guanine
CAS NO.:82410-32-0
Empirical Formula: C9H13N5O4
Molecular Weight: 255.23
MDL number: MFCD00870588
EINECS: 627-054-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100g | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250°C |
| Boiling point: | 398.46°C (rough estimate) |
| Density | 1.3559 (rough estimate) |
| refractive index | 1.7610 (estimate) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | 0.1 M HCl: 10 mg/mL |
| form | powder |
| pka | 9.33±0.20(Predicted) |
| color | white |
| Water Solubility | 3.6g/L(25 ºC) |
| ε(extinction coefficient) | 12.0 at 256nm at 1mM |
| Merck | 14,4363 |
| InChI | InChI=1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17) |
| InChIKey | IRSCQMHQWWYFCW-UHFFFAOYSA-N |
| SMILES | N1C2=C(N=C(N)NC2=O)N(COC(CO)CO)C=1 |
| CAS DataBase Reference | 82410-32-0(CAS DataBase Reference) |
Description and Uses
Ganciclovir is a parenterally-active antiviral agent indicated for sight- or life-threatening cytomegalovirus (CMV) infections in immunocompromised patients. Its suppressive effects on bone marrow and renal tubular secretion/absorption are reported to present potential limitations on adjunct therapies involving zidovudine, vincristine, adriamycin and amphotericin B. Recently, the emergence of CMV strains resistant to ganciclovir therapy has been reported.
antiemetic
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H340-H361fd |
| Precautionary statements | P201-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 46-60-61 |
| Safety Statements | 53-36/37/39-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| RTECS | MF8407000 |
| HS Code | 29335990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Muta. 1B |
| Hazardous Substances Data | 82410-32-0(Hazardous Substances Data) |
| Toxicity | LD50 i.p. in mice: 1-2 g/kg (Martin) |







