A4652712
Glycocholic acid , ≥97% , 475-31-0
Synonym(s):
3α,7α,12α-Trihydroxy-5β-cholan-24-oic acid N-(carboxymethyl)amide;Cholylglycine;N-(3α,7α,12α-Trihydroxy-24-oxocholan-24-yl)-glycine
CAS NO.:475-31-0
Empirical Formula: C26H43NO6
Molecular Weight: 465.63
MDL number: MFCD00065902
EINECS: 207-494-9
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB23.20 | In Stock |
|
| 250mg | RMB25.60 | In Stock |
|
| 500MG | RMB39.20 | In Stock |
|
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB162.40 | In Stock |
|
| 25g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128°C |
| Boiling point: | 568.76°C (rough estimate) |
| Density | 1.1336 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Refrigerator |
| solubility | methanol: 0.1 g/mL, clear, colorless |
| form | Solid |
| pka | 4.4(at 25℃) |
| color | White to Off-White |
| Water Solubility | 329.9mg/L(20 ºC) |
| Merck | 13,4507 |
| Stability: | Hygroscopic |
| InChIKey | RFDAIACWWDREDC-NSPZZGDONA-N |
| SMILES | N(CC(=O)O)C(=O)CC[C@H]([C@@H]1[C@@]2([C@H]([C@H]3[C@@H]([C@@]4([C@H](C[C@H]3O)C[C@@H](CC4)O)C)C[C@@H]2O)CC1)C)C |
| LogP | 1.650 |
| CAS DataBase Reference | 475-31-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Glycocholic acid(475-31-0) |
Description and Uses
N-Cholylglycine. Bile salt, conjugate of cholate and glycine, usually as the sodium salt. It acts as a detergent to solubilize fats for absorption and is itself absorbed. It is used as a cholagogue and choleretic.
Labelled Glycocholic Acid. The product of conjugation of cholic acid with glycine; chief ingredient of the bile of herbivorous animals. In the weakly alkaline bile fluid glycocholic acid exists as the sodium salt.



