A4682412
trans-3-Hydroxycinnamic acid , 99% , 14755-02-3
Synonym(s):
(E)-3-(3-Hydroxyphenyl)acrylic acid;m-Coumaric acid;trans-3-Hydroxycinnamic acid
CAS NO.:14755-02-3
Empirical Formula: C9H8O3
Molecular Weight: 164.16
MDL number: MFCD00004390
EINECS: 604-589-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB73.60 | In Stock |
|
| 10g | RMB128.80 | In Stock |
|
| 25G | RMB226.40 | In Stock |
|
| 50g | RMB431.20 | In Stock |
|
| 100G | RMB687.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195 °C(lit.) |
| Boiling point: | 231.61°C (rough estimate) |
| Density | 1.1403 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol,Benzene,Ethanol,Ether |
| pka | 4.38±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | Beige |
| Water Solubility | slightly soluble in water |
| BRN | 2690254 |
| InChI | 1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/b5-4+ |
| InChIKey | KKSDGJDHHZEWEP-SNAWJCMRSA-N |
| SMILES | OC(/C=C/C1=CC=CC(O)=C1)=O |
| LogP | 1.826 (est) |
| CAS DataBase Reference | 14755-02-3(CAS DataBase Reference) |
| NIST Chemistry Reference | m-Hydroxycinnamic acid(14755-02-3) |
| EPA Substance Registry System | 2-Propenoic acid, 3-(3-hydroxyphenyl)-, (2E)- (14755-02-3) |
Description and Uses
food and beverages
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![3-(6-Bromobenzo[d][1,3]dioxol-5-yl)acrylicacid](https://img.chemicalbook.com/CAS/GIF/27452-00-2.gif)

