A4682812
2,2,3,4,4,4-Hexafluorobutyl methacrylate , 96%, containing 30-70ppmmehq stabilizers , 36405-47-7
Synonym(s):
HFBMA
CAS NO.:36405-47-7
Empirical Formula: C8H8F6O2
Molecular Weight: 250.14
MDL number: MFCD00042311
EINECS: 628-322-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB187.20 | In Stock |
|
| 100G | RMB411.20 | In Stock |
|
| 500G | RMB1838.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 158 °C (lit.) |
| Density | 1.348 g/mL at 25 °C (lit.) |
| vapor pressure | 0.25 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 134 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.348 |
| Water Solubility | Difficult to mix in water. |
| Sensitive | Lachrymatory |
| BRN | 2725177 |
| InChI | 1S/C8H8F6O2/c1-4(2)5(15)16-3-7(10,11)6(9)8(12,13)14/h6H,1,3H2,2H3 |
| InChIKey | DFVPUWGVOPDJTC-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)C(F)(F)F |
| CAS DataBase Reference | 36405-47-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1H,1H,3H-Perfluorobutyl 2-methylacrylate (36405-47-7) |
Description and Uses
It is an epoxy thinner and is mainly used as the modifier of the (meth)acrylate resin. Well-defined organic/inorganic hybrid fluorinated star polymers were synthesized via atom transfer radical polymerization (ATRP) of 2,2,3,4,4,4-hexafluorobutyl methacrylate (HFBMA) using octa(aminophenyl)silsesquioxane (OAPS) nano-cage as initiator.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-36/37/39-37/39 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Lachrymatory |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29161400 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |








